CAS 302841-89-0
:Carbamic acid, (9H-xanthen-9-ylcarbonyl)-, butyl ester
Description:
Carbamic acid, (9H-xanthen-9-ylcarbonyl)-, butyl ester is an organic compound characterized by its structure, which includes a carbamic acid moiety linked to a butyl ester and a xanthenyl group. This compound typically exhibits properties associated with both carbamates and xanthene derivatives, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbamate functional group. The xanthenyl component may impart fluorescence, making it of interest in various applications, including dyes and fluorescent markers. Additionally, the butyl ester group can influence the compound's lipophilicity and biological activity. As with many organic compounds, its stability and reactivity can be affected by environmental conditions such as pH and temperature. The compound may also exhibit specific interactions with biological systems, which could be relevant in pharmacological contexts. Overall, its unique structural features suggest potential utility in fields such as medicinal chemistry, materials science, and analytical chemistry.
Formula:C19H19NO4
InChI:InChI=1S/C19H19NO4/c1-2-3-12-23-19(22)20-18(21)17-13-8-4-6-10-15(13)24-16-11-7-5-9-14(16)17/h4-11,17H,2-3,12H2,1H3,(H,20,21,22)
InChI key:InChIKey=RQBUXEUMZZQUFY-UHFFFAOYSA-N
SMILES:C(NC(OCCCC)=O)(=O)C1C=2C(OC=3C1=CC=CC3)=CC=CC2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Carbamic acid, N-(9H-xanthen-9-ylcarbonyl)-, butyl ester
CAS:Formula:C19H19NO4Purity:95%Color and Shape:SolidMolecular weight:325.3585Ro 67-4853
CAS:Controlled ProductApplications Ro 67-4853 is a positive allosteric modulator of metabotropic glutamate 1 receptor (1,2). Ro 67-4853 exhibits activity at all group I receptors such as human and rat mGlu1/mGlu5. It also enhance glutamate-induced calcium signaling through both the human and mouse mGlu1a receptors.
References Knoflach, et al.: Proc. Natl. Acad. Sci. 98, 13402 (2001) Hempstapat, et al.: Mol. Pharmacol., 70, 616 (2006)Formula:C19H19NO4Color and Shape:NeatMolecular weight:325.36Ro 67-4853
CAS:Ro 67-4853 is a positive allosteric modulator of mGluR1, selectively enhancing the response to the agonist (S)-3,5-dihydroxy-phenylglycine (DHPG).Formula:C19H19NO4Purity:98.57%Color and Shape:SolidMolecular weight:325.36


