CAS 3029-64-9

2,4,6-trichloropyrimidine-5-carbonitrile

Description:

2,4,6-Trichloropyrimidine-5-carbonitrile is a heterocyclic organic compound characterized by a pyrimidine ring substituted with three chlorine atoms and a cyano group. The presence of chlorine atoms at the 2, 4, and 6 positions of the pyrimidine ring significantly influences its chemical reactivity and physical properties, making it a polar compound with potential applications in pharmaceuticals and agrochemicals. The cyano group at the 5-position contributes to its ability to participate in nucleophilic reactions, enhancing its utility in synthetic chemistry. This compound is typically a solid at room temperature and may exhibit low solubility in non-polar solvents while being more soluble in polar solvents. Its structure allows for various chemical transformations, making it a valuable intermediate in the synthesis of more complex molecules. Safety data indicates that it should be handled with care due to its potential toxicity and environmental impact, necessitating appropriate safety measures during handling and disposal.

Formula: C₅Cl₃N₃

InChI: InChI=1/C5Cl3N3/c6-3-2(1-9)4(7)11-5(8)10-3

SMILES: C(#N)c1c(Cl)nc(Cl)nc1Cl

Synonyms:

• 5-Pyrimidinecarbonitrile, 2,4,6-trichloro-
• 2,4,6-Trichloro-5-cyanopyrimidine

5-Pyrimidinecarbonitrile, 2,4,6-trichloro-

CAS: 3029-64-9

Formula: C₅Cl₃N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.4326

Ref: IN-DA002ZHZ

2,4,6-Trichloro-5-cyanopyrimidine

CAS: 3029-64-9

2,4,6-Trichloro-5-cyanopyrimidine

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.43g/mol

Ref: 54-OR302358

2,4,6-Trichloro-5-cyanopyrimidine

CAS: 3029-64-9

Formula: C₅Cl₃N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.43

Ref: 10-F076882