CAS 302911-99-5

2,5-bis(trifluoromethyl)phenylaceto-nitrile

Description:

2,5-bis(trifluoromethyl)phenylacetonitrile is a chemical compound characterized by its unique structure, which includes a phenyl ring substituted with two trifluoromethyl groups and an acetonitrile functional group. The presence of the trifluoromethyl groups significantly enhances the compound's lipophilicity and stability, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit a crystalline form. Its molecular structure contributes to its potential reactivity, particularly in nucleophilic substitution reactions. Additionally, the presence of the nitrile group indicates that it may participate in various chemical transformations, such as hydrolysis or reduction. The compound's properties, including melting point, boiling point, and solubility, can vary based on the specific conditions and purity. Safety data should be consulted, as compounds with trifluoromethyl groups can exhibit toxicity and environmental persistence. Overall, 2,5-bis(trifluoromethyl)phenylacetonitrile is a notable compound in synthetic chemistry due to its distinctive characteristics and potential applications.

Formula: C₁₀H₅F₆N

InChI: InChI=1/C10H5F6N/c11-9(12,13)7-1-2-8(10(14,15)16)6(5-7)3-4-17/h1-2,5H,3H2

SMILES: c1cc(c(CC#N)cc1C(F)(F)F)C(F)(F)F

Synonyms:

• 2,5-Bis(trifluoromethyl)phenylacetonitrile

2-(2,5-Bis(trifluoromethyl)phenyl)acetonitrile

CAS: 302911-99-5

Formula: C₁₀H₅F₆N

Molecular weight: 253.1438

Ref: IN-DA002ZHG

2,5-Bis(trifluoromethyl)phenylacetonitrile

CAS: 302911-99-5

2,5-Bis(trifluoromethyl)phenylacetonitrile

Formula: C₁₀H₅F₆N

Purity: 98%

Color and Shape: Colourless Liquid

Molecular weight: 253.14g/mol

Ref: 54-PC5971

2,5-Bis(trifluoromethyl)phenylacetonitrile

CAS: 302911-99-5

Formula: C₁₀H₅F₆N

Purity: 97.0%

Molecular weight: 253.147

Ref: 10-F013767