CymitQuimica logo

CAS 302952-79-0

:

7-hydroxy-3-(4-methoxyphenoxy)-2-(trifluoromethyl)-4H-chromen-4-one

Description:
7-Hydroxy-3-(4-methoxyphenoxy)-2-(trifluoromethyl)-4H-chromen-4-one, with the CAS number 302952-79-0, is a synthetic organic compound belonging to the flavonoid class, specifically a chromone derivative. This compound features a chromone backbone, characterized by a benzopyran structure, which is substituted at various positions. The presence of a hydroxyl group at the 7-position contributes to its potential biological activity, while the trifluoromethyl group at the 2-position enhances lipophilicity and may influence its pharmacokinetic properties. The 4-methoxyphenoxy substituent at the 3-position can impart additional functional properties, potentially affecting its interaction with biological targets. This compound may exhibit antioxidant, anti-inflammatory, or other pharmacological activities, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C17H11F3O5
InChI:InChI=1/C17H11F3O5/c1-23-10-3-5-11(6-4-10)24-15-14(22)12-7-2-9(21)8-13(12)25-16(15)17(18,19)20/h2-8,21H,1H3
SMILES:COc1ccc(cc1)Oc1c(=O)c2ccc(cc2oc1C(F)(F)F)O
Synonyms:
  • 4H-1-Benzopyran-4-one, 7-hydroxy-3-(4-methoxyphenoxy)-2-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.