CymitQuimica logo

CAS 302963-94-6

:

N-Boc-2-amino-4-methylthiazole-5-carboxylic acid

Description:
N-Boc-2-amino-4-methylthiazole-5-carboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The "N-Boc" designation indicates that the amino group is protected by a tert-butyloxycarbonyl (Boc) group, which is commonly used in peptide synthesis to prevent unwanted reactions. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of a methyl group at the 4-position of the thiazole ring adds to its structural complexity and can influence its biological activity. N-Boc-2-amino-4-methylthiazole-5-carboxylic acid is often utilized in pharmaceutical research and development, particularly in the synthesis of bioactive molecules and as an intermediate in the preparation of more complex compounds. Its unique structural features make it a valuable building block in medicinal chemistry, where modifications can lead to compounds with desirable pharmacological properties.
Formula:C10H14N2O4S
InChI:InChI=1/C10H14N2O4S/c1-5-6(7(13)14)17-8(11-5)12-9(15)16-10(2,3)4/h1-4H3,(H,13,14)(H,11,12,15)
InChI key:FHNRXEYKJBDNKP-UHFFFAOYSA-N
SMILES:Cc1c(C(=O)O)sc(n1)N=C(O)OC(C)(C)C
Synonyms:
  • 2-[(tert-Butoxycarbonyl)amino]-4-methyl-1,3-thiazole-5-carboxylic acid
  • 5-Thiazolecarboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4-methyl-
  • N-Boc-Amino-4-Methylthiazole-5-Carboxylic Acid
Found 4 products.