CAS 303-97-9: Ubiquinone 9
Description:Ubiquinone 9, also known as coenzyme Q9, is a naturally occurring compound that plays a crucial role in the electron transport chain within mitochondria, facilitating ATP production through oxidative phosphorylation. It is a lipid-soluble molecule characterized by a long isoprenoid side chain, which contributes to its hydrophobic properties, allowing it to integrate into biological membranes. Ubiquinone 9 is involved in various biochemical processes, including acting as an antioxidant, protecting cells from oxidative damage, and participating in cellular respiration. Its structure features a quinone functional group, which is responsible for its redox properties, enabling it to alternate between oxidized and reduced states. This compound is synthesized in the body and can also be obtained from dietary sources, particularly in meats, fish, and certain oils. Ubiquinone 9 is often studied for its potential health benefits, including its role in energy metabolism and its implications in age-related diseases. Its CAS number, 303-97-9, uniquely identifies this specific compound in chemical databases.
Formula:C54H82O4
InChI:InChI=1S/C54H82O4/c1-40(2)22-14-23-41(3)24-15-25-42(4)26-16-27-43(5)28-17-29-44(6)30-18-31-45(7)32-19-33-46(8)34-20-35-47(9)36-21-37-48(10)38-39-50-49(11)51(55)53(57-12)54(58-13)52(50)56/h22,24,26,28,30,32,34,36,38H,14-21,23,25,27,29,31,33,35,37,39H2,1-13H3/b41-24+,42-26+,43-28+,44-30+,45-32+,46-34+,47-36+,48-38+
InChI key:InChIKey=UUGXJSBPSRROMU-WJNLUYJISA-N
SMILES:O=C1C(OC)=C(OC)C(=O)C(=C1C)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
- Synonyms:
- 2,3-Dimethoxy-5-methyl-6-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaen-1-yl]-2,5-cyclohexadiene-1,4-dione
- 2,5-Cyclohexadiene-1,4-dione, 2,3-dimethoxy-5-methyl-6-(3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaenyl)-, (all-E)-
- 2,5-Cyclohexadiene-1,4-dione, 2,3-dimethoxy-5-methyl-6-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaen-1-yl]-
- 2,5-Cyclohexadiene-1,4-dione, 2,3-dimethoxy-5-methyl-6-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaenyl]-
- CoQ<sub>9</sub>
- Coenzyme Q9
- Coenzyme Q<sub>9</sub>
- NSC 226993
- Ubiquinone 45
- Ubiquinone 9
- See more synonyms
- Ubiquinone Q<sub>9</sub>
- coenzyme Q9 from candida utilis
- p-Benzoquinone, 2,3-dimethoxy-5-methyl-6-(3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaenyl)-
