CymitQuimica logo

CAS 3030-54-4

:

benzene-1,3-dicarbothioamide

Description:
Benzene-1,3-dicarbothioamide, also known as 1,3-benzenedicarbothioamide, is an organic compound characterized by the presence of two thiocarbonamide functional groups attached to a benzene ring at the 1 and 3 positions. This compound typically appears as a solid and is soluble in organic solvents. Its molecular structure contributes to its potential reactivity, particularly in forming coordination complexes with metals due to the presence of sulfur atoms. The compound may exhibit properties such as moderate stability under standard conditions, but it can be sensitive to heat and light, which may lead to decomposition. Benzene-1,3-dicarbothioamide is of interest in various fields, including materials science and organic synthesis, where it may serve as a precursor or ligand in coordination chemistry. Additionally, its derivatives may possess biological activity, making it a subject of study in medicinal chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H8N2S2
InChI:InChI=1/C8H8N2S2/c9-7(11)5-2-1-3-6(4-5)8(10)12/h1-4H,(H2,9,11)(H2,10,12)
SMILES:c1cc(cc(c1)C(=N)S)C(=N)S
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.