CAS 30310-80-6
:N-Nitrosohydroxyproline
Description:
N-Nitrosohydroxyproline is a chemical compound that belongs to the class of nitroso compounds, characterized by the presence of a nitroso group (-N=O) attached to a hydroxyproline structure. It is typically a white to pale yellow solid, and its molecular structure includes a proline backbone with a hydroxyl group and a nitroso group, which can influence its reactivity and biological activity. This compound is of interest in various fields, including medicinal chemistry and toxicology, due to its potential role in biological systems and its implications in nitrosamine formation, which are known to be carcinogenic. N-Nitrosohydroxyproline may exhibit specific solubility properties, often being soluble in polar solvents, and its stability can be affected by environmental conditions such as pH and temperature. As with many nitroso compounds, it is essential to handle N-Nitrosohydroxyproline with care due to potential health risks associated with exposure. Further research is necessary to fully understand its biological effects and potential applications.
Formula:C5H8N2O4
InChI:InChI=1S/C5H8N2O4/c8-3-1-4(5(9)10)7(2-3)6-11/h3-4,8H,1-2H2,(H,9,10)/t3-,4+/m1/s1
InChI key:InChIKey=ABVBOWJCKJGCJM-DMTCNVIQSA-N
SMILES:C(O)(=O)[C@H]1N(N=O)C[C@H](O)C1
Synonyms:- (4R)-4-Hydroxy-1-nitroso-<span class="text-smallcaps">L</span>-proline
- <span class="text-smallcaps">L</span>-Proline, 4-hydroxy-1-nitroso-
- <span class="text-smallcaps">L</span>-Proline, 4-hydroxy-1-nitroso-, (4R)-
- <span class="text-smallcaps">L</span>-Proline, 4-hydroxy-1-nitroso-, trans-
- L-proline, 4-hydroxy-1-nitroso-, (4R)-
- N-Nitroso-4-hydroxyproline
- N-Nitrosohydroxyproline
- L-Proline, 4-hydroxy-1-nitroso-
- L-Proline, 4-hydroxy-1-nitroso-, trans-
- (4R)-4-Hydroxy-1-nitroso-L-proline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
(2S,4R)-4-Hydroxy-1-nitrosopyrrolidine-2-carboxylic acid
CAS:Formula:C5H8N2O4Color and Shape:SolidMolecular weight:160.1280N-Nitroso-L-hydroxyproline
CAS:Controlled ProductFormula:C5H8N2O4Color and Shape:Light BrownMolecular weight:160.13



