CAS 303136-82-5
:Neocuproine hydrochloride monohydrate
Description:
Neocuproine hydrochloride monohydrate is a chemical compound characterized by its role as a ligand in coordination chemistry, particularly known for its ability to form complexes with transition metals. It is a derivative of neocuproine, which is a bidentate ligand that can coordinate through its nitrogen atoms. The hydrochloride form indicates the presence of a hydrochloric acid moiety, enhancing its solubility in water. This compound typically appears as a crystalline solid and is often used in analytical chemistry, particularly in the detection and quantification of metal ions. Its monohydrate form suggests the presence of one water molecule per formula unit, which can influence its physical properties, such as solubility and stability. Neocuproine hydrochloride monohydrate is also noted for its fluorescent properties, making it useful in various applications, including photochemical studies and as a reagent in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C14H12N2.HCl.H2O
InChI:InChI=1/C14H12N2.ClH/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;/h3-8H,1-2H3;1H
SMILES:Cc1ccc2ccc3ccc(C)nc3c2n1.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Neocuproine Hydrochloride Monohydrate
CAS:Formula:C14H12N2·HCl·H2OPurity:>99.0%(HPLC)Color and Shape:White to Dark green powder to crystalMolecular weight:262.742,9-Dimethyl-1,10-phenanthroline hydrochloride monohydrate
CAS:Formula:C14H15ClN2OPurity:99%Color and Shape:SolidMolecular weight:262.73472,9-Dimethyl-1,10-phenanthroline Hydrochloride Monohydrate
CAS:<p>2,9-Dimethyl-1,10-phenanthroline Hydrochloride Monohydrate</p>Purity:99%Molecular weight:262.74g/mol2,9-Dimethyl-1,10-phenanthroline hydrochloride monohydrate
CAS:<p>Chelating agent used to detect aqueous copper ions by electrochemiluminescence</p>Formula:C14H12N2·HCl·H2OColor and Shape:White PowderMolecular weight:262.73 g/molNeocuproine hydrochloride hydrate
CAS:Formula:C14H15ClN2OPurity:99%(HPLC);RGColor and Shape:Liquid, No data available.Molecular weight:262.742,9-Dimethyl-1,10-phenanthroline hydrochloride monohydrate
CAS:<p>Please enquire for more information about 2,9-Dimethyl-1,10-phenanthroline hydrochloride monohydrate including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C14H12N2·HCl·H2OMolecular weight:262.73 g/mol




