CAS 303137-77-1

4-[(3-chloro-4-fluorophenyl)amino]-4-oxobutanoic acid

Description:

4-[(3-chloro-4-fluorophenyl)amino]-4-oxobutanoic acid, identified by its CAS number 303137-77-1, is a chemical compound that features a butanoic acid backbone with a ketone and an amino group substituted at the 4-position. The presence of a 3-chloro-4-fluorophenyl group enhances its potential for biological activity, making it of interest in pharmaceutical research. This compound is likely to exhibit polar characteristics due to the carboxylic acid functional group, which can participate in hydrogen bonding, influencing its solubility in polar solvents like water. The halogen substituents (chlorine and fluorine) can also affect the compound's electronic properties and reactivity. Additionally, the structural configuration may allow for specific interactions with biological targets, which is crucial for its potential applications in drug development. Overall, this compound's unique functional groups and structural features contribute to its chemical behavior and potential utility in various chemical and biological contexts.

Formula: C₁₀H₉ClFNO₃

InChI: InChI=1/C10H9ClFNO3/c11-7-5-6(1-2-8(7)12)13-9(14)3-4-10(15)16/h1-2,5H,3-4H2,(H,13,14)(H,15,16)

SMILES: c1cc(c(cc1N=C(CCC(=O)O)O)Cl)F

Synonyms:

• Butanoic Acid, 4-[(3-Chloro-4-Fluorophenyl)Amino]-4-Oxo-

4-[(3-chloro-4-fluorophenyl)amino]-4-oxobutanoic acid

CAS: 303137-77-1

Formula: C₁₀H₉ClFNO₃

Molecular weight: 245.6348

Ref: IN-DA002ZNN

4-[(3-chloro-4-fluorophenyl)amino]-4-oxobutanoic acid

CAS: 303137-77-1

Formula: C₁₀H₉ClFNO₃

Purity: 95.0%

Molecular weight: 245.63

Ref: 10-F310138