
CAS 303148-73-4
:6-Chloro-1-[(3,4-dichlorophenyl)methoxy]-2-phenyl-1H-benzimidazole
Description:
6-Chloro-1-[(3,4-dichlorophenyl)methoxy]-2-phenyl-1H-benzimidazole is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole core substituted with a chloro group and a methoxy group linked to a dichlorophenyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many benzimidazole derivatives. Its molecular structure suggests potential biological activity, particularly in pharmacological applications, as benzimidazoles are known for their roles in various therapeutic areas, including anti-parasitic and anti-cancer activities. The presence of multiple chlorine atoms may enhance its lipophilicity and influence its interaction with biological targets. Additionally, the compound's stability and reactivity can be affected by the substituents on the aromatic rings, making it a subject of interest in medicinal chemistry and drug development. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C20H13Cl3N2O
InChI:InChI=1S/C20H13Cl3N2O/c21-15-7-9-18-19(11-15)25(20(24-18)14-4-2-1-3-5-14)26-12-13-6-8-16(22)17(23)10-13/h1-11H,12H2
InChI key:InChIKey=HLJAMPGGUACYDS-UHFFFAOYSA-N
SMILES:O(CC1=CC(Cl)=C(Cl)C=C1)N2C(=NC=3C2=CC(Cl)=CC3)C4=CC=CC=C4
Synonyms:- 6-Chloro-1-[(3,4-dichlorophenyl)methoxy]-2-phenyl-1H-benzimidazole
- 1H-Benzimidazole, 6-chloro-1-[(3,4-dichlorophenyl)methoxy]-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.