
CAS 303150-49-4
:4-Chloro-1-(3-chlorophenyl)-1,6-dihydro-6-oxo-3-pyridazinecarbonitrile
Description:
4-Chloro-1-(3-chlorophenyl)-1,6-dihydro-6-oxo-3-pyridazinecarbonitrile is a chemical compound characterized by its pyridazine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. This compound features a chloro substituent at the 4-position and a phenyl group with an additional chlorine atom at the 3-position, contributing to its unique reactivity and potential biological activity. The presence of the carbonitrile functional group enhances its chemical properties, making it a candidate for various applications in medicinal chemistry and agrochemicals. The dihydro-6-oxo structure indicates that it possesses a ketone functionality, which can participate in various chemical reactions. The compound's molecular structure suggests potential interactions with biological targets, making it of interest for research in pharmacology. Its CAS number, 303150-49-4, allows for easy identification and reference in chemical databases. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with implications for further study in synthetic and applied chemistry.
Formula:C11H5Cl2N3O
InChI:InChI=1S/C11H5Cl2N3O/c12-7-2-1-3-8(4-7)16-11(17)5-9(13)10(6-14)15-16/h1-5H
InChI key:InChIKey=PBLQXKAJWZDHDU-UHFFFAOYSA-N
SMILES:O=C1N(N=C(C#N)C(Cl)=C1)C2=CC(Cl)=CC=C2
Synonyms:- 4-Chloro-1-(3-chlorophenyl)-1,6-dihydro-6-oxo-3-pyridazinecarbonitrile
- 3-Pyridazinecarbonitrile, 4-chloro-1-(3-chlorophenyl)-1,6-dihydro-6-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.