CAS 303175-44-2

2-[(2-chloro-4-iodophenyl)amino]-3,4-difluorobenzoic acid

Description:

2-[(2-chloro-4-iodophenyl)amino]-3,4-difluorobenzoic acid, with the CAS number 303175-44-2, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with both fluorine and halogen atoms. This compound features a chloro and an iodo group on the phenyl ring, contributing to its unique reactivity and potential biological activity. The presence of difluorobenzoic acid enhances its acidity and may influence its solubility and interaction with biological targets. The amino group serves as a functional site for further chemical modifications or interactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential as a bioactive agent. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods. Overall, the unique combination of halogen and fluorine substituents suggests that this compound could exhibit interesting chemical behavior and biological activity.

Formula: C₁₃H₇ClF₂INO₂

InChI: InChI=1/C13H7ClF2INO2/c14-8-5-6(17)1-4-10(8)18-12-7(13(19)20)2-3-9(15)11(12)16/h1-5,18H,(H,19,20)

SMILES: c1cc(c(cc1I)Cl)Nc1c(ccc(c1F)F)C(=O)O

Benzoic acid, 2-[(2-chloro-4-iodophenyl)amino]-3,4-difluoro-

CAS: 303175-44-2

Formula: C₁₃H₇ClF₂INO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 409.5545

Ref: IN-DA002ZR1

2-((2-Chloro-4-Iodophenyl)Amino)-3,4-Difluorobenzoic Acid

CAS: 303175-44-2

2-((2-Chloro-4-Iodophenyl)Amino)-3,4-Difluorobenzoic Acid

Purity: 97%

Molecular weight: 409.55g/mol

Ref: 54-PC108689

zapnometinib

CAS: 303175-44-2

zapnometinib

Purity: ≥98%

Molecular weight: 409.55g/mol

Ref: 54-BUP10948

zapnometinib

CAS: 303175-44-2

Zapnometinib (ATR-002) is a MEK inhibitor.

Formula: C₁₃H₇ClF₂INO₂

Purity: 99.67%

Color and Shape: Solid

Molecular weight: 409.55

Ref: TM-T9321

2-(2-Chloro-4-iodophenylamino)-3,4-difluorobenzoic Acid

Controlled Product

CAS: 303175-44-2

Applications 2-(2-Chloro-4-iodophenylamino)-3,4-difluorobenzoic Acid (cas# 303175-44-2) is a compound useful in organic synthesis.

Formula: C₁₃H₇ClF₂INO₂

Color and Shape: Neat

Molecular weight: 409.55

Ref: TR-C367210