CAS 303186-14-3
:2-Ethyl-2-adamantyl acrylate
Description:
2-Ethyl-2-adamantyl acrylate is an organic compound characterized by its acrylate functional group, which contributes to its reactivity and utility in polymer chemistry. This substance features a bulky adamantyl group, providing significant steric hindrance, which can influence its physical and chemical properties, such as solubility and reactivity. It is typically a colorless to pale yellow liquid with a characteristic odor. The compound is known for its ability to undergo free radical polymerization, making it valuable in the production of various polymers and copolymers. Additionally, the presence of the ethyl group enhances its solubility in organic solvents. Safety data indicates that, like many acrylates, it may be irritating to the skin and eyes, and appropriate handling precautions should be taken. Overall, 2-Ethyl-2-adamantyl acrylate is utilized in applications ranging from coatings to adhesives, owing to its unique structural features and reactivity profile.
Formula:C15H22O2
InChI:InChI=1S/C15H22O2/c1-3-14(16)17-15(4-2)12-6-10-5-11(8-12)9-13(15)7-10/h3,10-13H,1,4-9H2,2H3
InChI key:InChIKey=NLNVUFXLNHSIQH-UHFFFAOYSA-N
SMILES:O(C(C=C)=O)C1(CC)C2CC3CC1CC(C2)C3
Synonyms:- Adamantate EA
- 2-Ethyl-2-adamantyl acrylate
- 2-Propenoic acid, 2-ethyltricyclo[3.3.1.13,7]dec-2-yl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
