CAS 3032-11-9
:Ethanaminium, 2-ethoxy-N,N,N-trimethyl-2-oxo-, chloride (1:1)
Description:
Ethanaminium, 2-ethoxy-N,N,N-trimethyl-2-oxo-, chloride (1:1), commonly referred to as a quaternary ammonium compound, is characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This compound features a trimethylated nitrogen atom bonded to an ethoxy group and an oxo group, contributing to its unique chemical properties. It is typically soluble in polar solvents, which enhances its utility in various applications, including as a surfactant or antimicrobial agent. The chloride ion serves as a counterion, balancing the positive charge of the ethanaminium cation. This compound may exhibit biological activity, making it of interest in pharmaceutical and agricultural research. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many quaternary ammonium compounds, it may also possess surface-active properties, allowing it to interact with biological membranes or surfaces, which can be beneficial in formulations for cleaning or disinfecting agents. Safety data should be consulted for handling and potential toxicity.
Formula:C7H16NO2·Cl
InChI:InChI=1S/C7H16NO2.ClH/c1-5-10-7(9)6-8(2,3)4;/h5-6H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=JFCJMBHZZMQZAI-UHFFFAOYSA-M
SMILES:C(C[N+](C)(C)C)(OCC)=O.[Cl-]
Synonyms:- (2-Ethoxy-2-oxoethyl)trimethylazanium chloride
- (Carbethoxymethyl)trimethylammonium chloride
- (Carboxymethyl)trimethylammonium chloride, ethyl ester
- 2-ethoxy-N,N,N-trimethyl-2-oxoethanaminium chloride
- Ammonium, (carboxymethyl)trimethyl-, chloride, ethyl ester
- Betaine Ethyl Ester Chloride
- Ethanaminium, 2-ethoxy-N,N,N-trimethyl-2-oxo-, chloride
- Ethanaminium, 2-ethoxy-N,N,N-trimethyl-2-oxo-, chloride (1:1)
- N-<(ethoxycarbonyl)methyl>trimethylammonium chloride
- ethoxycarbonylmethyltrimethylammonium chloride
- 2-ethoxy-n,n,n-trimethyl-2-oxo-ethanaminiuchloride
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
