CAS 3032-92-6
:4-Ethynylbenzonitrile
Description:
4-Ethynylbenzonitrile, with the CAS number 3032-92-6, is an organic compound characterized by its aromatic structure featuring a cyano group (-C≡N) and an ethynyl group (-C≡C-) attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its utility in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The presence of the ethynyl group imparts unique reactivity, making it a valuable intermediate in coupling reactions, such as Sonogashira coupling, which is widely used in the formation of carbon-carbon bonds. Additionally, 4-Ethynylbenzonitrile exhibits moderate solubility in organic solvents, while its cyano group contributes to its polar characteristics. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 4-Ethynylbenzonitrile is a significant compound in synthetic organic chemistry with diverse applications.
Formula:C9H5N
InChI:InChI=1/C9H5N/c1-2-8-3-5-9(7-10)6-4-8/h1,3-6H
SMILES:C#Cc1ccc(cc1)C#N
Synonyms:- Benzonitrile, 4-ethynyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Ethynylbenzonitrile, 97%
CAS:4-Ethynylbenzonitrile is used as a synthetic fragment and as a test compound for cross-coupling reactions. It is used in the study of hydrogen bond formation in multifunctional molecules due to the presence of four hydrogen bonding sites. It is also involved in the preparation of 4-[(trimethylsilyl)Formula:C9H5NPurity:97%Color and Shape:White to dark brown, Powder or crystalsMolecular weight:127.154-Ethynylbenzonitrile
CAS:Formula:C9H5NPurity:>97.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:127.154-Ethynylbenzonitrile
CAS:4-EthynylbenzonitrileFormula:C9H5NPurity:≥95%Color and Shape: light yellow to yellow solidMolecular weight:127.1427g/mol




