CAS 30320-28-6
:1,1,1,2,2,3,3,5,5,5-decafluoro-4-(trifluoromethyl)pentane
Description:
1,1,1,2,2,3,3,5,5,5-decafluoro-4-(trifluoromethyl)pentane, with CAS number 30320-28-6, is a fluorinated organic compound characterized by its high fluorine content, which imparts unique properties such as low surface tension and high thermal stability. This compound is a colorless liquid at room temperature and exhibits low volatility, making it useful in various applications, including as a solvent and in specialty chemical formulations. Its structure features a pentane backbone with multiple fluorine substituents, contributing to its hydrophobic nature and resistance to degradation. The presence of the trifluoromethyl group enhances its chemical stability and reactivity profile. Additionally, due to its fluorinated nature, it may have implications for environmental persistence and bioaccumulation, necessitating careful handling and assessment of its ecological impact. Overall, this compound is of interest in fields such as materials science and chemical engineering, where its unique properties can be leveraged for innovative applications.
Formula:C6HF13
InChI:InChI=1/C6HF13/c7-2(8,5(15,16)6(17,18)19)1(3(9,10)11)4(12,13)14/h1H
SMILES:C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F
Synonyms:- Pentane, 1,1,1,2,2,3,3,5,5,5-Decafluoro-4-(Trifluoromethyl)-
- 1,1,1,2,2,3,3,5,5,5-Decafluoro-4-(trifluoromethyl)pentane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2H-Tridecafluoro-2-methylpentane
CAS:<p>2H-Tridecafluoro-2-methylpentane</p>Formula:C6HF13Purity:97%Color and Shape: clear liquidMolecular weight:320.05g/mol2H-Perfluoro(2-Methylpentane)
CAS:<p>2H-perfluoro(2-methylpentanes) is a versatile solvent that has various applications in research and industry. It is commonly used as a solvent in high-resolution mass spectrometry and multinuclear NMR experiments due to its ability to dissolve a wide range of compounds. This compound also exhibits unique properties such as magnetic anisotropy, which makes it useful in studies involving magnetic materials. Additionally, 2H-perfluoro(2-methylpentanes) can be used as a medium for the activation of interferon and plasmids in biological research. Its electrochemical properties have been studied using techniques like electrochemical impedance spectroscopy, revealing insights into its protonation behavior and conductivity. The structure of this compound has been characterized using X-ray diffraction data, providing valuable information about its molecular arrangement. Overall, 2H-perfluoro(2-methylpentanes) is a highly versatile solvent that finds applications in various scientific fields ranging from chemistry to biology.</p>Formula:C6HF13Purity:Min. 95%Molecular weight:320.05 g/mol

