CymitQuimica logo

CAS 30321-94-9

:

5-bromo-2-(methylsulfonyl)pyrimidine-4-carboxylic acid

Description:
5-Bromo-2-(methylsulfonyl)pyrimidine-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both a bromine atom and a methylsulfonyl group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and biological activity. The methylsulfonyl group contributes to the compound's polar characteristics, enhancing its solubility in polar solvents. The carboxylic acid functional group provides acidic properties, allowing for potential interactions in biological systems, such as hydrogen bonding and ionic interactions. This compound is of interest in medicinal chemistry and pharmaceutical research due to its potential applications in drug development, particularly in targeting specific biological pathways. Its structural features suggest it may exhibit antimicrobial or anti-inflammatory properties, although specific biological activities would need to be confirmed through empirical studies. Overall, 5-bromo-2-(methylsulfonyl)pyrimidine-4-carboxylic acid is a versatile compound with significant implications in chemical and pharmaceutical research.
Formula:C6H5BrN2O4S
InChI:InChI=1/C6H5BrN2O4S/c1-14(12,13)6-8-2-3(7)4(9-6)5(10)11/h2H,1H3,(H,10,11)
InChI key:UEYGRSDYBWXDKJ-UHFFFAOYSA-N
SMILES:CS(=O)(=O)c1ncc(c(C(=O)O)n1)Br
Synonyms:
  • 4-Pyrimidinecarboxylic Acid, 5-Bromo-2-(Methylsulfonyl)-
  • 2-Methylsulfonyl-5-bromopyrimidine-4-carboxylicacid
  • 5-Bromo-2-(methylsulfonyl)pyrimidine-4-carboxylic acid
Found 3 products.