CAS 3033-82-7
:8-Chloroquinaldine
Description:
8-Chloroquinaldine is an organic compound characterized by its structure, which features a quinoline backbone with a chlorine substituent at the 8-position. This compound is typically a pale yellow to brown solid and is known for its aromatic properties, which contribute to its stability and reactivity. It is moderately soluble in organic solvents but has limited solubility in water. 8-Chloroquinaldine is primarily used in the synthesis of various pharmaceuticals and agrochemicals, owing to its potential as an intermediate in chemical reactions. Additionally, it exhibits biological activity, which has been explored in various studies, particularly in the context of antimicrobial and antitumor properties. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use. Overall, 8-Chloroquinaldine is a significant compound in organic chemistry with various applications in research and industry.
Formula:C10H8ClN
InChI:InChI=1/C10H8ClN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3
SMILES:Cc1ccc2cccc(c2n1)Cl
Synonyms:- 8-Chloro-2-methylquinoline
- 2-Methyl-8-chloroquinoline
- Quinaldine, 8-chloro-
- Quinoline, 8-chloro-2-methyl-
- 8-CHLOROQUINALDINE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
8-Chloro-2-methylquinoline, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H8ClNPurity:98%Color and Shape:Crystals or powder or crystalline powder or fused solid, Pale cream to creamMolecular weight:177.63Quinoline, 8-chloro-2-methyl-
CAS:Formula:C10H8ClNPurity:98%Color and Shape:SolidMolecular weight:177.6302
