CAS 30332-56-0

1-(3,4-dimethoxyphenyl)-2-(morpholin-4-yl)ethanol

Description:

1-(3,4-Dimethoxyphenyl)-2-(morpholin-4-yl)ethanol, with the CAS number 30332-56-0, is an organic compound characterized by its complex structure, which includes a phenolic moiety and a morpholine ring. This compound features a 3,4-dimethoxyphenyl group, which contributes to its aromatic properties and potential for various interactions due to the presence of methoxy substituents that can influence its reactivity and solubility. The morpholine ring adds to its pharmacological potential, as morpholines are often associated with biological activity. The hydroxyl (-OH) group in the ethanol part of the molecule enhances its polarity, making it more soluble in polar solvents. This compound may exhibit interesting biological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas targeting central nervous system disorders or other therapeutic areas where morpholine derivatives are known to be effective. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₄H₂₁NO₄

InChI: InChI=1/C14H21NO4/c1-17-13-4-3-11(9-14(13)18-2)12(16)10-15-5-7-19-8-6-15/h3-4,9,12,16H,5-8,10H2,1-2H3

SMILES: COc1ccc(cc1OC)C(CN1CCOCC1)O

1-(3,4-Dimethoxyphenyl)-2-(morpholin-4-yl)ethan-1-ol

Controlled Product

CAS: 30332-56-0

Versatile small molecule scaffold

Formula: C₁₄H₂₁NO₄

Purity: Min. 95%

Molecular weight: 267.32 g/mol

Ref: 3D-FBA33256