CAS 30334-04-4
:methyl 6-cyano-9,10-didehydroergoline-8-carboxylate
Description:
Methyl 6-cyano-9,10-didehydroergoline-8-carboxylate, identified by its CAS number 30334-04-4, is a chemical compound belonging to the class of ergoline derivatives. This substance features a complex bicyclic structure characteristic of ergoline alkaloids, which are known for their diverse biological activities. The presence of a cyano group and a carboxylate ester contributes to its reactivity and potential pharmacological properties. Typically, compounds in this category may exhibit interactions with various neurotransmitter systems, making them of interest in medicinal chemistry and pharmacology. The methyl ester functionality can influence solubility and bioavailability, which are critical factors in drug development. Additionally, the compound's structural features may allow for modifications that enhance its therapeutic efficacy or reduce side effects. As with many ergoline derivatives, research into its specific biological effects and potential applications is ongoing, highlighting the importance of understanding its chemical behavior and interactions in biological systems.
Formula:C17H15N3O2
InChI:InChI=1/C17H15N3O2/c1-22-17(21)11-5-13-12-3-2-4-14-16(12)10(7-19-14)6-15(13)20(8-11)9-18/h2-5,7,11,15,19H,6,8H2,1H3
SMILES:COC(=O)C1C=C2c3cccc4c3c(CC2N(C1)C#N)c[nH]4
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
d-6-Cyano-6-norlysergic Acid Methyl Ester
CAS:Controlled ProductApplications d-6-Cyano-6-norlysergic Acid Methyl Ester has antitumor activity.
References Portlock, David. et al., J. Med. Chem. 18,764-5(1975);Formula:C17H15N3O2Color and Shape:NeatMolecular weight:293.32D-6-Cyano-6-norlysergic acid methyl ester
CAS:Please enquire for more information about D-6-Cyano-6-norlysergic acid methyl ester including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C17H15N3O2Purity:Min. 95%Molecular weight:293.32 g/molRef: 3D-FBA33404
Discontinued product

