CAS 3034-32-0
:N-Phenyl-4-pyridinemethanamine
Description:
N-Phenyl-4-pyridinemethanamine, also known as 4-(N-phenylmethyl)pyridine, is an organic compound characterized by its pyridine and phenyl functional groups. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its aromatic properties due to the presence of the phenyl group. The compound features a pyridine ring, which is a six-membered heterocyclic aromatic ring containing one nitrogen atom, contributing to its basicity and potential reactivity. N-Phenyl-4-pyridinemethanamine can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it useful in organic synthesis and medicinal chemistry. Its structure allows for interactions with biological systems, which may lead to applications in pharmaceuticals or agrochemicals. However, safety data should be consulted, as with any chemical substance, to understand its toxicity, handling precautions, and environmental impact. Overall, N-Phenyl-4-pyridinemethanamine is a compound of interest in both research and industrial applications due to its unique chemical properties.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c1-2-4-12(5-3-1)14-10-11-6-8-13-9-7-11/h1-9,14H,10H2
InChI key:InChIKey=IRJVUOQNBSTXGA-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)C=2C=CN=CC2
Synonyms:- 4-[(Phenylamino)methyl]pyridine
- N-Phenyl-4-pyridinemethanamine
- Pyridine, 4-(anilinomethyl)-
- 4-Pyridinemethanamine, N-phenyl-
- 4-(Anilinomethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
