CAS 3034-47-7

2-chloro-5-nitro-1,3-thiazole

Description:

2-Chloro-5-nitro-1,3-thiazole is a heterocyclic compound characterized by the presence of a thiazole ring, which contains both sulfur and nitrogen atoms. The compound features a chlorine atom at the 2-position and a nitro group at the 5-position of the thiazole ring, contributing to its reactivity and potential applications in various chemical processes. It is typically a yellow to brown solid, exhibiting moderate solubility in organic solvents. The presence of the nitro group enhances its electrophilic properties, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the chlorine substituent can influence its biological activity and interaction with other molecules. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2-chloro-5-nitro-1,3-thiazole is a valuable compound in research and industrial applications due to its unique structural features and reactivity.

Formula: C₃HClN₂O₂S

InChI: InChI=1/C3HClN2O2S/c4-3-5-1-2(9-3)6(7)8/h1H

SMILES: c1c(N(=O)=O)sc(Cl)n1

Synonyms:

• Thiazole, 2-Chloro-5-Nitro-
• 2-Chloro-5-Nitrothiazole

Thiazole, 2-chloro-5-nitro-

CAS: 3034-47-7

Formula: C₃HClN₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.5702

Ref: IN-DA002ZTD

2-Chloro-5-nitrothiazole

CAS: 3034-47-7

2-Chloro-5-nitrothiazole

Purity: 97%

Molecular weight: 164.57g/mol

Ref: 54-OR96515

2-Chloro-5-nitrothiazole

CAS: 3034-47-7

Formula: C₃HClN₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.56

Ref: 10-F076557