CymitQuimica logo

CAS 3034-56-8

:

5-Bromo-2-chlorothiazole

Description:
5-Bromo-2-chlorothiazole is a heterocyclic compound characterized by the presence of both bromine and chlorine substituents on a thiazole ring. The thiazole structure consists of a five-membered ring containing both sulfur and nitrogen atoms, contributing to its unique chemical properties. This compound typically appears as a solid and is known for its reactivity due to the presence of halogen atoms, which can participate in various substitution reactions. It is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. The presence of the bromine and chlorine atoms can enhance the compound's biological activity and influence its solubility and stability. Additionally, 5-Bromo-2-chlorothiazole may exhibit antimicrobial or antifungal properties, making it of interest in various research applications. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns. Proper storage and disposal methods are essential to mitigate any potential hazards associated with its use.
Formula:C3HBrClNS
InChI:InChI=1S/C3HBrClNS/c4-2-1-6-3(5)7-2/h1H
InChI key:InChIKey=DKJFZOGJTDCZQU-UHFFFAOYSA-N
SMILES:BrC=1SC(Cl)=NC1
Synonyms:
  • 5-Bromo-2-chloro-1,3-thiazole
  • Thiazole, 5-bromo-2-chloro-
  • 5-Bromo-2-chlorothiazole
Found 5 products.