CAS 30355-60-3
:6-(chloromethyl)-N-phenyl-1,3,5-triazine-2,4-diamine
Description:
6-(Chloromethyl)-N-phenyl-1,3,5-triazine-2,4-diamine, with the CAS number 30355-60-3, is a chemical compound characterized by its triazine ring structure, which is a six-membered aromatic heterocycle containing three nitrogen atoms. This compound features a chloromethyl group, which enhances its reactivity, and a phenyl group that contributes to its overall stability and hydrophobic characteristics. The presence of amino groups at the 2 and 4 positions of the triazine ring indicates potential for hydrogen bonding and reactivity, making it useful in various chemical applications, including as a building block in organic synthesis and potentially in agrochemical formulations. Its chloromethyl group can participate in nucleophilic substitution reactions, allowing for further functionalization. The compound's properties, such as solubility, melting point, and reactivity, can vary based on the specific conditions and solvents used. Overall, this compound is of interest in fields such as medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C10H10ClN5
InChI:InChI=1/C10H10ClN5/c11-6-8-14-9(12)16-10(15-8)13-7-4-2-1-3-5-7/h1-5H,6H2,(H3,12,13,14,15,16)
SMILES:c1ccc(cc1)N=c1[nH]c(CCl)nc(=N)[nH]1
Synonyms:- 1,3,5-triazine-2,4-diamine, 6-(chloromethyl)-N~2~-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
