CAS 3037-04-5: Ethanethiol, 2-amino-, 4-methylbenzenesulfonate (1:1)

Description:Ethanethiol, 2-amino-, 4-methylbenzenesulfonate (1:1), with the CAS number 3037-04-5, is a chemical compound that features both an amino group and a sulfonate group, making it a sulfonic acid derivative. This compound typically exhibits properties associated with both amines and sulfonates, such as being polar and soluble in water due to the presence of the sulfonate group. The ethanethiol moiety contributes to its potential reactivity, particularly in nucleophilic substitution reactions. The presence of the methyl group on the benzene ring can influence its steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. This compound may be used in various applications, including as a reagent in organic synthesis or in the development of pharmaceuticals. Safety data should be consulted, as compounds containing thiol groups can be malodorous and may have specific handling requirements due to their potential toxicity and reactivity.

Formula:C₇H₈O₃S·C₂H₇NS

InChI:InChI=1S/C7H8O3S.C2H7NS/c1-6-2-4-7(5-3-6)11(8,9)10;3-1-2-4/h2-5H,1H3,(H,8,9,10);4H,1-3H2

InChI key:InChIKey=MWESMYJLFQVSSO-UHFFFAOYSA-N

SMILES:O=S(=O)(O)C1=CC=C(C=C1)C.SCCN

Synonyms:
(Mercaptoethyl)ammonium toluene-p-sulfonate
2-Aminoethanethiol 4-Methylbenzenesulfonate
2-Aminoethanethiol p-toluenosulfonate
2-Mercaptoethylamine p-toluenesulfonate
Ethanethiol, 2-amino-, 4-methylbenzenesulfonate (1:1)
Ethanethiol, 2-amino-, 4-methylbenzenesulfonate (salt)
Ethanethiol, 2-amino-, p-toluenesulfonate
Ethanethiol, 2-amino-, p-toluenesulfonate (salt)

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Aminoethanethiol p-Toluenesulfonate REF: 3B-A0946CAS: 3037-04-5	>98.0%(T)	118.00 €	Fri 25 Apr 25
Ethanethiol, 2-amino-, 4-methylbenzenesulfonate (1:1) REF: IN-DA002ZW6CAS: 3037-04-5	98%	100.00 €~687.00 €	Fri 02 May 25
2-Aminoethanethiol P-Toluenesulfonate REF: 54-OR1029625CAS: 3037-04-5	98%	32.00 €~2,241.00 €	Mon 05 May 25
2-Aminoethanethiol p-Toluenesulfonate REF: 3D-DAA03704CAS: 3037-04-5	Min. 95%	- - -	Discontinued product