CAS 303727-31-3: 2-chloro-5-(2-phenyl-5-pyridin-4-yl-1H-imidazol-4-yl)phenol
Description:2-Chloro-5-(2-phenyl-5-pyridin-4-yl-1H-imidazol-4-yl)phenol is a chemical compound characterized by its complex structure, which includes a phenolic group, a chloro substituent, and an imidazole moiety linked to a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity due to the presence of the imidazole and pyridine rings, which are often involved in interactions with biological targets. The chloro group can influence the compound's reactivity and solubility, while the phenolic hydroxyl group may contribute to hydrogen bonding capabilities. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their antimicrobial, anti-inflammatory, and anticancer properties. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its utility in various chemical and biological contexts.
Formula:C20H14ClN3O
InChI:InChI=1/C20H14ClN3O/c21-16-7-6-15(12-17(16)25)19-18(13-8-10-22-11-9-13)23-20(24-19)14-4-2-1-3-5-14/h1-12,25H,(H,23,24)
- Synonyms:
- 2-(Phenyl)-4-(3-hydroxy-4-chlorophenyl)-5-(4-pyridyl)-1H-imidazole
- 2-chloro-5-[2-phenyl-4-(pyridin-4-yl)-1H-imidazol-5-yl]phenol
- phenol, 2-chloro-5-[2-phenyl-4-(4-pyridinyl)-1H-imidazol-5-yl]-
- Phenol, 2-chloro-5-[2-phenyl-5-(4-pyridinyl)-1H-imidazol-4-yl]-
- 2-Chloro-5-[2-phenyl-5-(pyridin-4-yl)-1H-imidazol-4-yl]phenol

Phenol, 2-chloro-5-[2-phenyl-4-(4-pyridinyl)-1H-imidazol-5-yl]-
Ref: IN-DA002ZWS
5mg | 118.00 € | ||
25mg | 139.00 € | ||
50mg | 168.00 € | ||
100mg | 284.00 € |

Ref: 54-BUP05676
25mg | 291.00 € | ||
50mg | 528.00 € | ||
100mg | 833.00 € |

L-779450
Ref: TM-T1953
2mg | 49.00 € | ||
5mg | 73.00 € | ||
10mg | 107.00 € | ||
25mg | 188.00 € | ||
50mg | 354.00 € | ||
100mg | 567.00 € | ||
1mL*10mM (DMSO) | 82.00 € |

Ref: 54-BISN0240
50mg | 204.00 € | ||
100mg | 331.00 € |

2-Chloro-5-(2-phenyl-5-(pyridin-4-yl)-1H-imidazol-4-yl)phenol
Ref: 10-F321254
5mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

L-779450
Controlled ProductRef: TR-L010000
750mg | 11,848.00 € |

L 779450
Ref: 3D-FL24820
1g | 2,660.00 € | ||
250mg | 1,368.00 € | ||
500mg | 2,000.00 € |