CAS 30379-55-6
:Benzyloxyacetic acid
Description:
Benzyloxyacetic acid is an organic compound characterized by the presence of both a benzyloxy group and a carboxylic acid functional group. Its molecular structure features a benzene ring attached to an ether linkage (the benzyloxy group) and a carboxylic acid (-COOH) group, which contributes to its acidic properties. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic benzene ring. Benzyloxyacetic acid is known for its potential applications in pharmaceuticals and organic synthesis, particularly as an intermediate in the preparation of various bioactive compounds. Its reactivity is influenced by the presence of the carboxylic acid group, allowing for various chemical transformations, such as esterification and amidation. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H10O3
InChI:InChI=1S/C9H10O3/c10-9(11)7-12-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)
InChI key:InChIKey=GRZHHTYDZVRPIC-UHFFFAOYSA-N
SMILES:C(OCC(O)=O)C1=CC=CC=C1
Synonyms:- 2-(Benzyloxy)Acetic Acid
- 2-(Phenylmethoxy)acetic acid
- 2-Benzyloxyacetic acid
- Acetic acid, (benzyloxy)-
- Acetic acid, (phenylmethoxy)-
- Acetic acid, 2-(phenylmethoxy)-
- Benzyloxy Acctic Acid
- Glycolic acid-benzyl ether
- NSC 153415
- (Benzyloxy)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzyloxyacetic Acid
CAS:Formula:C9H10O3Purity:>97.0%(GC)(T)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:166.18Benzyloxyacetic acid, 95%
CAS:It is a compound for proteomics research use. It may be used for following synthesis mixed benzyloxyacetic pivalic anhydride, chiral glycolates, 1,2:4,5-di-O-isopropylidene--D-fructopyranos-3-yl benzyloxyacetate, via esterification, tetra aqua(1,10-phenanthroline-[]2N,N?)magnesium(II) bis[(2,4-dichlFormula:C9H10O3Purity:95%Color and Shape:Colorless to yellow, LiquidMolecular weight:166.18Acetic acid, 2-(phenylmethoxy)-
CAS:Formula:C9H10O3Purity:95%Color and Shape:LiquidMolecular weight:166.1739Benzyloxyacetic acid
CAS:Benzyloxyacetic acidFormula:C9H10O3Purity:98%Color and Shape: light brown viscous solidMolecular weight:166.17g/mol2-(Benzyloxy)acetic acid
CAS:2-(Benzyloxy)acetic acid is a phenoxy compound that inhibits the enzyme amide and has been used to treat metabolic disorders. It has also been used as an inhibitor of enzymes in the synthetic pathway, such as 2-benzyloxyacetate, which is an intermediate in the biosynthesis of benzoic acid. 2-(Benzyloxy)acetic acid has also been shown to have degenerative disease-fighting properties and has been used to treat autoimmune diseases. This drug is synthetically made from aromatic halides by a process called asymmetric synthesis. The chemical name for this drug is 4-Hydroxy-2-[(2-benzyloxy)acetyl]phenol, but it can also be referred to as benzophenone-1 or BP1.
Formula:C9H10O3Purity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:166.17 g/mol





