CAS 30379-58-9
:benzyl glycolate
Description:
Benzyl glycolate, with the CAS number 30379-58-9, is an organic compound characterized by its ester functional group, formed from the reaction of benzyl alcohol and glycolic acid. It typically appears as a colorless to pale yellow liquid with a pleasant, sweet, floral aroma, making it useful in the fragrance and flavoring industries. The compound is known for its solubility in organic solvents, while being less soluble in water, which is a common trait of many esters. Benzyl glycolate exhibits moderate volatility and can be used as a solvent or a plasticizer in various applications. Additionally, it may possess mild skin irritant properties, necessitating caution during handling. Its chemical structure contributes to its reactivity, allowing it to participate in various chemical reactions, including hydrolysis and transesterification. Overall, benzyl glycolate is valued for its aromatic qualities and versatility in formulations, particularly in cosmetics and personal care products.
Formula:C9H10O3
InChI:InChI=1/C9H10O3/c10-6-9(11)12-7-8-4-2-1-3-5-8/h1-5,10H,6-7H2
SMILES:c1ccc(cc1)COC(=O)CO
Synonyms:- Benzyl Hydroxyacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzyl Glycolate
CAS:Formula:C9H10O3Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:166.18Acetic acid, 2-hydroxy-, phenylmethyl ester
CAS:Formula:C9H10O3Purity:95%Color and Shape:LiquidMolecular weight:166.1739Benzyl Glycolate
CAS:Controlled ProductApplications Benzyl Glycolate was utilized as a potential moiety for the preparation of phosphonate dipeptides as potential inhibitors of VanX.
References Jia, C., et al.: BIoorg. Med. Chem. Lett., 22, 482 (2012);Formula:C9H10O3Color and Shape:NeatMolecular weight:166.17Benzyl glycolate
CAS:Benzyl glycolate is a small molecule that has been shown to have cell-maturation activity. It is synthesized from the reaction of benzaldehyde and glyoxylic acid with sodium hydroxide. The product contains a hydroxyl group, which is an important structural feature for the synthesis of drugs and other compounds. Benzyl glycolate is soluble in water and methanol, but insoluble in ether or chloroform. It is not toxic to mammalian cells, but has been shown to have receptor activity. Benzyl glycolate also reacts with toll-like receptor 4 (TLR-4) on macrophages and dendritic cells, which initiates the production of inflammatory cytokines such as TNF-α and IL-1β. This compound degrades through ester linkages to produce benzoic acid and glycine.Formula:C9H10O3Purity:Min. 95%Color and Shape:Colourless To Yellow To Orange LiquidMolecular weight:166.17 g/mol





