CymitQuimica logo

CAS 30384-93-1

:

2-methylimidazo[1,2-a]pyridine-3-carbaldehyde

Description:
2-Methylimidazo[1,2-a]pyridine-3-carbaldehyde is an organic compound characterized by its fused imidazole and pyridine rings, which contribute to its heterocyclic structure. This compound features a methyl group at the second position of the imidazole ring and an aldehyde functional group at the third position of the pyridine ring. It is typically a pale yellow to brown solid, exhibiting moderate solubility in organic solvents. The presence of the aldehyde group makes it reactive, particularly in condensation reactions and as a potential electrophile in various organic syntheses. This compound is of interest in the field of medicinal chemistry and toxicology, as it is structurally related to certain mutagenic and carcinogenic compounds. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR and mass spectrometry. Safety precautions should be taken when handling this compound due to its potential biological effects.
Formula:C9H8N2O
InChI:InChI=1/C9H8N2O/c1-7-8(6-12)11-5-3-2-4-9(11)10-7/h2-6H,1H3
InChI key:MCSIFRRJDAQKML-UHFFFAOYSA-N
SMILES:Cc1c(C=O)n2ccccc2n1
Synonyms:
  • Imidazo[1,2-a]pyridine-3-carboxaldehyde, 2-methyl-
  • 2-Methyl-iMidazo[1,2-a]pyridine-3-carbaldehyde
Found 5 products.