CAS 30389-37-8
:5-Methoxy-1,2,3,4-tetrahydroquinoline hydrochloride (1:1)
Description:
5-Methoxy-1,2,3,4-tetrahydroquinoline hydrochloride is a chemical compound characterized by its tetrahydroquinoline structure, which features a fused bicyclic system containing both a benzene and a piperidine ring. The presence of a methoxy group (-OCH3) at the 5-position contributes to its unique chemical properties, potentially influencing its reactivity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. Its molecular interactions can be influenced by the methoxy group, which may participate in hydrogen bonding or hydrophobic interactions. Safety and handling precautions should be observed, as with any chemical substance, and its use should comply with relevant regulations and guidelines.
Formula:C10H14ClNO
InChI:InChI=1/C10H13NO.ClH/c1-12-10-6-2-5-9-8(10)4-3-7-11-9;/h2,5-6,11H,3-4,7H2,1H3;1H
SMILES:COc1cccc2c1CCCN2.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-methoxy-1,2,3,4-tetrahydroquinoline
CAS:<p>5-methoxy-1,2,3,4-tetrahydroquinoline is an anticancer agent that targets cancer cells by interfering with their metabolism. It has been shown to inhibit the growth of cancer cells in vitro and in vivo. This compound is a potential therapeutic for Alzheimer's disease and other neurological disorders due to its ability to cross the blood-brain barrier. 5-methoxy-1,2,3,4-tetrahydroquinoline is able to bind selectively with DNA or RNA molecules and modify them without affecting the surrounding healthy cells. The fluorescent properties of this molecule allow it to be detected easily in tissues. 5-methoxy-1,2,3,4-tetrahydroquinoline can be conjugated with different drugs or imaging agents for multifunctional treatment of cancer.</p>Formula:C10H13NOPurity:Min. 95%Molecular weight:163.21 g/mol
