
CAS 3039-10-9
:Kynurenine
Description:
Kynurenine is an endogenous metabolite of the amino acid tryptophan, playing a significant role in various biological processes. It is primarily involved in the kynurenine pathway, which is a major route for tryptophan catabolism. Kynurenine is characterized by its structure, which includes an indole ring and a side chain containing an amine and a carboxylic acid functional group. This compound exhibits various biological activities, including neuroprotective and neurotoxic effects, depending on its concentration and the presence of other metabolites in the kynurenine pathway. Kynurenine is also implicated in immune regulation and has been studied for its potential role in psychiatric disorders, such as depression and schizophrenia. Additionally, it can influence the production of neurotransmitters and has been linked to oxidative stress and inflammation. Due to its diverse physiological roles, kynurenine is of interest in pharmacological research, particularly in the context of neurodegenerative diseases and mental health.
Formula:C10H12N2O3
InChI:InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)
InChI key:InChIKey=YGPSJZOEDVAXAB-UHFFFAOYSA-N
SMILES:C(CC(C(O)=O)N)(=O)C1=C(N)C=CC=C1
Synonyms:- Benzenebutanoic acid, α,2-diamino-γ-oxo-
- Kynurenine
- α,2-Diamino-γ-oxobenzenebutanoic acid
- Alanine, 3-anthraniloyl-
- 3-Anthraniloylalanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.