CAS 3039-63-2
:8,11-Eicosadienoic acid
Description:
8,11-Eicosadienoic acid, also known as 8,11-icosadienoic acid, is a long-chain unsaturated fatty acid characterized by the presence of two double bonds located at the 8th and 11th carbon positions of its 20-carbon chain. This fatty acid is part of the omega-6 family, which is essential for various biological functions in the body. It is typically found in certain plant oils and is known for its role in cellular signaling and membrane structure. The presence of double bonds contributes to its fluidity and reactivity, making it an important component in lipid metabolism. 8,11-Eicosadienoic acid can be synthesized through various biochemical pathways and is of interest in nutritional studies due to its potential health benefits, including anti-inflammatory properties. Its CAS number, 3039-63-2, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. Overall, this fatty acid plays a significant role in both human health and industrial applications.
Formula:C20H36O2
InChI:InChI=1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10,12-13H,2-8,11,14-19H2,1H3,(H,21,22)
InChI key:InChIKey=XUJWOMMOEOHPFP-UHFFFAOYSA-N
SMILES:C(=CCC=CCCCCCCCC)CCCCCCC(O)=O
Synonyms:- 8,11-Eicosadienoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
