CAS 303988-17-2
:4-[(4-Methylphenyl)thio]-3-nitro-N-2-propen-1-ylbenzamide
Description:
4-[(4-Methylphenyl)thio]-3-nitro-N-2-propen-1-ylbenzamide, identified by its CAS number 303988-17-2, is an organic compound characterized by its complex structure, which includes a benzamide core substituted with a nitro group and a thioether moiety. This compound features a 4-methylphenyl group linked via a sulfur atom, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The propenyl group introduces unsaturation, which can further participate in addition reactions. In terms of solubility, compounds of this nature often exhibit moderate solubility in organic solvents, while their solubility in water may be limited due to hydrophobic characteristics. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups can impart specific biological activities. Overall, the characteristics of this compound make it an interesting subject for further study in synthetic chemistry and material science.
Formula:C17H16N2O3S
InChI:InChI=1S/C17H16N2O3S/c1-3-10-18-17(20)13-6-9-16(15(11-13)19(21)22)23-14-7-4-12(2)5-8-14/h3-9,11H,1,10H2,2H3,(H,18,20)
InChI key:InChIKey=AQCPBCOFNSIREQ-UHFFFAOYSA-N
SMILES:S(C1=C(N(=O)=O)C=C(C(NCC=C)=O)C=C1)C2=CC=C(C)C=C2
Synonyms:- Benzamide, 4-[(4-methylphenyl)thio]-3-nitro-N-2-propen-1-yl-
- Benzamide, 4-[(4-methylphenyl)thio]-3-nitro-N-2-propenyl-
- 4-[(4-Methylphenyl)thio]-3-nitro-N-2-propen-1-ylbenzamide
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery