CymitQuimica logo

CAS 303994-55-0

:

Methyl 1-(4-methoxybenzoyl)-4-piperidinecarboxylate

Description:
Methyl 1-(4-methoxybenzoyl)-4-piperidinecarboxylate, identified by its CAS number 303994-55-0, is a chemical compound characterized by its piperidine structure, which includes a methoxybenzoyl group and a methyl ester functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential solubility in organic solvents. The presence of the methoxy group enhances its lipophilicity, which may influence its biological activity and interaction with various receptors or enzymes. Additionally, the piperidine ring can impart basic characteristics, allowing for potential protonation under acidic conditions. Methyl 1-(4-methoxybenzoyl)-4-piperidinecarboxylate may be of interest in medicinal chemistry for its potential pharmacological applications, particularly in the development of new therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, including esterification and possibly coupling reactions to form the desired structure. As with many organic compounds, safety data and handling precautions should be considered due to potential toxicity or reactivity.
Formula:C15H19NO4
InChI:InChI=1S/C15H19NO4/c1-19-13-5-3-11(4-6-13)14(17)16-9-7-12(8-10-16)15(18)20-2/h3-6,12H,7-10H2,1-2H3
InChI key:InChIKey=BYEVNGWLJHRGSD-UHFFFAOYSA-N
SMILES:C(=O)(N1CCC(C(OC)=O)CC1)C2=CC=C(OC)C=C2
Synonyms:
  • Methyl 1-(4-methoxybenzoyl)-4-piperidinecarboxylate
  • 4-Piperidinecarboxylic acid, 1-(4-methoxybenzoyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.