CAS 303996-05-6

4-[[(2-Chlorophenyl)methyl]thio]-3-nitrobenzaldehyde O-[(2,6-dichlorophenyl)methyl]oxime

Description:

4-[[(2-Chlorophenyl)methyl]thio]-3-nitrobenzaldehyde O-[(2,6-dichlorophenyl)methyl]oxime, with the CAS number 303996-05-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a nitro group, an aldehyde functional group, and an oxime. The presence of the thioether linkage and multiple aromatic rings contributes to its potential reactivity and solubility properties. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and pharmacology. Its chlorinated phenyl groups can influence its electronic properties and interactions with biological targets. Additionally, the compound's stability, solubility in various solvents, and potential applications in research or industry would depend on its specific chemical behavior, which can be influenced by environmental factors. Overall, this compound represents a class of organic molecules that may have significant implications in various fields, including drug development and chemical synthesis.

Formula: C₂₁H₁₅Cl₃N₂O₃S

InChI: InChI=1S/C21H15Cl3N2O3S/c22-17-5-2-1-4-15(17)13-30-21-9-8-14(10-20(21)26(27)28)11-25-29-12-16-18(23)6-3-7-19(16)24/h1-11H,12-13H2

InChI key: InChIKey=YRVAZSDQLNRJSK-UHFFFAOYSA-N

SMILES: S(CC1=C(Cl)C=CC=C1)C2=C(N(=O)=O)C=C(C=NOCC3=C(Cl)C=CC=C3Cl)C=C2

Synonyms:

• Benzaldehyde, 4-[[(2-chlorophenyl)methyl]thio]-3-nitro-, O-[(2,6-dichlorophenyl)methyl]oxime
• 4-[[(2-Chlorophenyl)methyl]thio]-3-nitrobenzaldehyde O-[(2,6-dichlorophenyl)methyl]oxime