CymitQuimica logo

CAS 303997-53-7

:

6-(Dimethylamino)-α-phenyl-3-pyridazineacetonitrile

Description:
6-(Dimethylamino)-α-phenyl-3-pyridazineacetonitrile, with the CAS number 303997-53-7, is a chemical compound characterized by its unique structure that includes a pyridazine ring, a phenyl group, and a dimethylamino substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may include moderate to high stability under standard conditions. It is likely to be soluble in organic solvents due to its non-polar characteristics, while its polar functional groups may impart some degree of solubility in polar solvents. The presence of the dimethylamino group suggests potential basicity, which could influence its reactivity and interactions with other chemical species. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. However, specific reactivity, toxicity, and environmental impact would require further investigation through empirical studies and safety assessments.
Formula:C14H14N4
InChI:InChI=1S/C14H14N4/c1-18(2)14-9-8-13(16-17-14)12(10-15)11-6-4-3-5-7-11/h3-9,12H,1-2H3
InChI key:InChIKey=GWTNXVVXWAWFKQ-UHFFFAOYSA-N
SMILES:C(C#N)(C1=CC=C(N(C)C)N=N1)C2=CC=CC=C2
Synonyms:
  • 6-(Dimethylamino)-α-phenyl-3-pyridazineacetonitrile
  • 3-Pyridazineacetonitrile, 6-(dimethylamino)-α-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.