CAS 304-06-3
:2-Hydroxy[1,1′-biphenyl]-3-carboxylic acid
Description:
2-Hydroxy[1,1′-biphenyl]-3-carboxylic acid, also known as salicylic acid derivative, is an organic compound characterized by its biphenyl structure with hydroxyl and carboxylic acid functional groups. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxyl and carboxylic acid groups. It exhibits acidic properties due to the carboxylic acid moiety, which can donate protons in solution. The compound is known for its potential applications in pharmaceuticals, particularly in the synthesis of anti-inflammatory and analgesic agents, as well as in the field of organic synthesis. Additionally, it may possess antioxidant properties and can be involved in various chemical reactions, including esterification and amidation. Its structural features contribute to its reactivity and interactions with biological systems, making it a compound of interest in medicinal chemistry and materials science.
Formula:C13H10O3
InChI:InChI=1S/C13H10O3/c14-12-10(9-5-2-1-3-6-9)7-4-8-11(12)13(15)16/h1-8,14H,(H,15,16)
InChI key:InChIKey=ZJWUEJOPKFYFQD-UHFFFAOYSA-N
SMILES:OC1=C(C=CC=C1C(O)=O)C2=CC=CC=C2
Synonyms:- Salicylic acid, 3-phenyl-
- 3-Biphenylcarboxylic acid, 2-hydroxy-
- 3-Phenylsalicylic acid
- 2-Hydroxy[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 2-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Phenylsalicylic Acid
CAS:Formula:C13H10O3Purity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:214.22[1,1'-Biphenyl]-3-carboxylic acid, 2-hydroxy-
CAS:Formula:C13H10O3Purity:95%Color and Shape:SolidMolecular weight:214.21672-Hydroxy-[1,1'-biphenyl]-3-carboxylic acid
CAS:<p>2-Hydroxy-[1,1'-biphenyl]-3-carboxylic acid (2HBC) is a monomer that belongs to the group of ester compounds. It has been shown to inhibit the growth of trichophyton mentagrophytes and other fungi by forming hydrogen bonds with the enzyme activities in the cell wall. 2HBC also inhibits microbial growth by binding to enzymes such as phospholipase A2, cyclooxygenase, and lipoxygenase, which are involved in inflammatory processes. This drug also inhibits bacterial growth by binding to the ribosome, preventing protein synthesis and leading to cell death. The inhibition of microbial growth is not limited to bacteria; it also occurs in fungi and protozoa. 2HBC has been shown to be active against both extracellular and intracellular microbial infections.</p>Formula:C13H10O3Purity:Min. 95%Molecular weight:214.22 g/mol






