CAS 304-55-2: meso-2,3-Dimercaptosuccinic acid
Description:Meso-2,3-Dimercaptosuccinic acid (DMSA) is a chelating agent with the chemical formula C4H6O4S2. It is characterized by the presence of two thiol (-SH) groups, which confer its ability to bind heavy metals and facilitate their excretion from the body. DMSA is a white crystalline solid that is soluble in water, making it suitable for various pharmaceutical applications, particularly in the treatment of heavy metal poisoning, such as lead and mercury toxicity. The compound exhibits a meso configuration, meaning it has a plane of symmetry and is optically inactive despite having chiral centers. DMSA is typically administered orally or intravenously and is known for its relatively low toxicity compared to other chelating agents. Additionally, it has been studied for its potential antioxidant properties and its role in reducing oxidative stress. Overall, meso-2,3-Dimercaptosuccinic acid is an important compound in both clinical and environmental chemistry contexts.
Formula:C4H6O4S2
InChI:InChI=1/C4H6O4S2/c5-3(6)1(9)2(10)4(7)8/h1-2,9-10H,(H,5,6)(H,7,8)/t1-,2+
InChI key:InChIKey=ACTRVOBWPAIOHC-XIXRPRMCNA-N
SMILES:O=C(O)C(S)C(S)C(=O)O
- Synonyms:
- (2R,3S)-2,3-disulfanylbutanedioate
- (2R,3S)-2,3-disulfanylbutanedioic acid
- 2,3-Dimercaptosuccinic acid
- 2,3-Disulfanylbutanedioic Acid
- Butanedioic acid, 2,3-dimercapto-, (2R,3S)-rel-
- Butanedioic acid, 2,3-dimercapto-, (R*,S*)-
- Chemet
- DMS
- Dim-Sa
- Dimercaptosuccinic Acid
- See more synonyms
- Dmsa
- Ro 1-7977
- Succimer
- Succimero
- Succinic acid, 2,3-dimercapto-, meso-
- meso-Dimercaptosuccinic acid
- rel-(2R,3S)-2,3-Dimercaptobutanedioic acid
