CAS 30407-41-1
:2,2,3,3-tetramethylbutanoic acid
Description:
2,2,3,3-Tetramethylbutanoic acid is a branched-chain carboxylic acid characterized by its four methyl groups attached to a butanoic acid backbone. This structure contributes to its unique physical and chemical properties. It is typically a colorless liquid or solid at room temperature, exhibiting a relatively low volatility due to its larger molecular size. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and neutralization. Its branched structure can influence its solubility in organic solvents, generally making it more soluble in non-polar solvents compared to polar solvents. Additionally, the steric hindrance from the methyl groups can affect its reactivity and interactions with other molecules. This compound may be used in organic synthesis and as an intermediate in the production of various chemical products. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H16O2
InChI:InChI=1/C8H16O2/c1-7(2,3)8(4,5)6(9)10/h1-5H3,(H,9,10)
SMILES:CC(C)(C)C(C)(C)C(=O)O
Synonyms:- Butanoic Acid, 2,2,3,3-Tetramethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,2,3,3-Tetramethylbutanoic acid
CAS:2,2,3,3-Tetramethylbutanoic acid is a superacid that reacts with carbon and oxygen to form carbon monoxide and hydrogen gas. The reaction of 2,2,3,3-tetramethylbutanoic acid with an alkane forms a carboxylic acid. When 2,2,3,3-tetramethylbutanoic acid is heated with an alkene in the presence of sodium metal or potassium tert-butoxide it undergoes an isomerization reaction to form a 1-alkene. This reaction can also be carried out using a catalyst such as nickel or palladium on charcoal.Formula:C8H16O2Purity:Min. 95%Molecular weight:144.21 g/mol

