CAS 30408-30-1
:8-(hydroxymethyl)-6,11-dimethyl-4H-[1,3]oxazolo[5,4,3-ij]pyrido[3,2-g]quinoline-4,10(11H)-dione
Description:
The chemical substance known as 8-(hydroxymethyl)-6,11-dimethyl-4H-[1,3]oxazolo[5,4,3-ij]pyrido[3,2-g]quinoline-4,10(11H)-dione, with the CAS number 30408-30-1, is a complex organic compound characterized by its unique bicyclic structure that incorporates both oxazole and quinoline moieties. This compound features multiple functional groups, including hydroxymethyl and dimethyl substituents, which contribute to its chemical reactivity and potential biological activity. The presence of the oxazole ring suggests possible applications in medicinal chemistry, as oxazole derivatives are often explored for their pharmacological properties. Additionally, the compound's structural complexity may influence its solubility, stability, and interaction with biological targets. While specific data on its physical properties, such as melting point or solubility, may not be readily available, compounds of this nature are typically investigated for their potential use in drug development or as intermediates in organic synthesis. Further studies would be necessary to elucidate its full range of characteristics and applications.
Formula:C16H14N2O4
InChI:InChI=1/C16H14N2O4/c1-8-3-13(21)18-7-22-16-14-11(5-10(8)15(16)18)9(6-19)4-12(20)17(14)2/h3-5,19H,6-7H2,1-2H3
SMILES:Cc1cc(=O)n2COc3c4c(cc1c23)c(cc(=O)n4C)CO
Synonyms:- 2H,4H-oxazolo[5,4,3-ij]pyrido[3,2-g]quinoline-4,10(11H)-dione, 8-(hydroxymethyl)-6,11-dimethyl-
- 30408-30-1
- 6,11-Dimethyl-8-(hydroxymethyl)pyrido[3,2-g]oxazolo[5,4,3-ij]quinoline-4,10(2H,11H)-dione
- 8-(Hydroxymethyl)-6,11-dimethyl-2H,4H-oxazolo[5,4,3-ij]pyrido[3,2-g]quinoline-4,10(11H)-dione
- Nybomycin derivative
- 8-(Hydroxymethyl)-6,11-dimethyl-4H-[1,3]oxazolo[5,4,3-ij]pyrido[3,2-g]quinoline-4,10(11H)-dione
- 8-(Hydroxymethyl)-6,11-dimethyl-4H-(1,3)oxazolo(5,4,3-ij)pyrido(3,2-g)quinoline-4,10(11H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Nybomycin
CAS:<p>Nybomycin, a fungal metabolite from Streptomyces sp. A717, has antibacterial properties; effective against various bacteria including M. tuberculosis.</p>Formula:C16H14N2O4Color and Shape:SolidMolecular weight:298.298

