CAS 30411-81-5
:2-ethyl-6-methyl-1H-benzimidazole
Description:
2-Ethyl-6-methyl-1H-benzimidazole is an organic compound characterized by its bicyclic structure, which consists of a fused benzene and imidazole ring. This compound features an ethyl group at the 2-position and a methyl group at the 6-position of the benzimidazole framework. It is typically a white to off-white solid, exhibiting moderate solubility in organic solvents. The presence of the imidazole ring contributes to its potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound may exhibit properties such as antifungal or antibacterial activity, although specific biological effects can vary based on structural modifications and environmental conditions. Its molecular structure allows for potential interactions with biological macromolecules, which can be explored for drug development. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, 2-ethyl-6-methyl-1H-benzimidazole represents a versatile structure with applications in medicinal chemistry and materials science.
Formula:C10H12N2
InChI:InChI=1/C10H12N2/c1-3-10-11-8-5-4-7(2)6-9(8)12-10/h4-6H,3H2,1-2H3,(H,11,12)
SMILES:CCc1nc2ccc(C)cc2[nH]1
Synonyms:- 1H-benzimidazole, 2-ethyl-5-methyl-
- 2-Ethyl-5-methyl-1H-benzimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Ethyl-5-methyl-1H-1,3-benzodiazole
CAS:<p>2-Ethyl-5-methyl-1H-1,3-benzodiazole is a chemical compound with the molecular formula C10H12N2. It is a white solid that is soluble in organic solvents such as benzene. This substance has shown to be a potent, noncompetitive inhibitor of the enzyme nucleoprotein. 2-Ethyl-5-methyl-1H-1,3-benzodiazole has been shown to have carcinogenic properties and can cause liver tumors in rats. The mechanism of action for this substance may be due to its ability to inhibit the metabolism of vitamin A and other chemicals in the liver by competitive inhibition with enzymes such as cytochrome P450.</p>Formula:C10H12N2Purity:Min. 95%Molecular weight:160.22 g/mol

