CAS 30413-58-2
:2-Ethynyl-6-methylpyridine
Description:
2-Ethynyl-6-methylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an ethynyl group (-C≡CH) at the 2-position and a methyl group (-CH3) at the 6-position of the pyridine ring, contributing to its unique reactivity and properties. It is a colorless to pale yellow liquid with a distinct odor, and it is soluble in organic solvents such as ethanol and ether but has limited solubility in water. The presence of the ethynyl group makes it a useful building block in organic synthesis, particularly in the formation of more complex molecules through reactions like cross-coupling and nucleophilic additions. Additionally, 2-Ethynyl-6-methylpyridine may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Proper storage in a cool, dry place away from light is recommended to maintain its stability.
Formula:C8H7N
InChI:InChI=1S/C8H7N/c1-3-8-6-4-5-7(2)9-8/h1,4-6H,2H3
InChI key:InChIKey=RUFOVPQUNXLVFW-UHFFFAOYSA-N
SMILES:C(#C)C=1N=C(C)C=CC1
Synonyms:- 6-Ethynyl-2-picoline
- 2-Ethynyl-6-methylpyridine
- Pyridine, 2-ethynyl-6-methyl-
- 6-Methyl-2-pyridylacetylene
- 2-Picoline, 6-ethynyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyridine, 2-ethynyl-6-methyl-
CAS:Formula:C8H7NPurity:97%Color and Shape:LiquidMolecular weight:117.14792-Ethynyl-6-methylpyridine
CAS:<p>2-Ethynyl-6-methylpyridine (EMPy) is a cytostatic agent that inhibits the synthesis of DNA, RNA and proteins. EMPy is used as an antiviral agent to inhibit the replication of hepatitis B virus, herpes simplex virus type 1 and 2 and varicella zoster virus. It also has chemoselective properties, which means that it reacts only with one type of molecule at a time. EMPy can be synthesized by cross-coupling reactions between deoxyribonucleosides and pyridine nucleophiles. The resulting EMPy can be converted into nucleophilic substitutions or eliminated by unselective cross-coupling reactions with nucleophilic reagents.</p>Formula:C8H7NPurity:Min. 95%Molecular weight:117.15 g/mol



