CAS 30414-55-2
:Methyl 5-methyl-3-oxohexanoate
Description:
Methyl 5-methyl-3-oxohexanoate, with the CAS number 30414-55-2, is an organic compound that belongs to the class of esters. It is characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound typically exhibits a fruity odor, common to many esters, and is often used in flavoring and fragrance applications. Its molecular structure includes a hexanoate backbone with a ketone functional group at the 3-position and a methyl group at the 5-position, contributing to its unique chemical properties. Methyl 5-methyl-3-oxohexanoate is generally soluble in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. In terms of reactivity, it can participate in various chemical reactions typical of esters, such as hydrolysis and transesterification. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H14O3
InChI:InChI=1/C8H14O3/c1-6(2)4-7(9)5-8(10)11-3/h6H,4-5H2,1-3H3
SMILES:CC(C)CC(=O)CC(=O)OC
Synonyms:- Hexanoic Acid, 5-Methyl-3-Oxo-, Methyl Ester
- Methyl .alpha.-isovalerylacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Hexanoic acid, 5-methyl-3-oxo-, methyl ester
CAS:Formula:C8H14O3Purity:97%Color and Shape:LiquidMolecular weight:158.1950Methyl 5-methyl-3-oxohexanoate
CAS:Methyl 5-methyl-3-oxohexanoate is an organic ester compound widely used in biochemical experiments and drug synthesis research.Formula:C8H14O3Color and Shape:SolidMolecular weight:158.25-Methyl-3-oxohexanoic acid methyl ester
CAS:5-Methyl-3-oxohexanoic acid methyl esterPurity:98%Molecular weight:158.197g/molMethyl 5-methyl-3-oxohexanoate
CAS:Formula:C8H14O3Purity:95%Color and Shape:LiquidMolecular weight:158.1975-Methyl-3-oxo-hexanoic acid methyl ester
CAS:Versatile small molecule scaffoldFormula:C8H14O3Purity:Min. 95%Molecular weight:158.2 g/mol




