
CAS 30421-42-2
:Bicyclo[2.2.1]hept-5-ene-2-methanol, homopolymer
Description:
Bicyclo[2.2.1]hept-5-ene-2-methanol, homopolymer, identified by CAS number 30421-42-2, is a synthetic polymer derived from bicyclic monomers. This compound features a bicyclic structure that contributes to its unique physical and chemical properties. The polymerization of the bicyclic monomer results in a material that exhibits a high degree of rigidity and thermal stability, making it suitable for various applications in materials science. The presence of hydroxyl groups in the structure enhances its potential for hydrogen bonding, which can improve solubility in polar solvents and increase adhesion properties. Additionally, the polymer may demonstrate interesting mechanical properties, such as toughness and flexibility, depending on its molecular weight and degree of cross-linking. Its unique structure also allows for potential modifications, enabling the development of tailored materials for specific applications, including coatings, adhesives, and composites. Overall, this polymer represents a versatile class of materials with promising characteristics for industrial use.
Formula:(C8H12O)x
InChI:InChI=1S/C8H12O/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-9H,3-5H2
InChI key:InChIKey=LUMNWCHHXDUKFI-UHFFFAOYSA-N
SMILES:C(O)C1C2CC(C1)C=C2
Synonyms:- 5-Norbornene-2-methanol homopolymer
- Bicyclo[2.2.1]hept-5-ene-2-methanol, homopolymer
- 5-(Hydroxymethyl)norbornene homopolymer
- 5-(Hydroxymethyl)-2-norbornene homopolymer
- 5-Norbornene-2-methanol, polymers
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
