CAS 30432-08-7
:9-(hydroxymethyl)-6,6-dimethyl-3-pentyl-6H-benzo[c]chromen-1-ol
Description:
9-(Hydroxymethyl)-6,6-dimethyl-3-pentyl-6H-benzo[c]chromen-1-ol, with the CAS number 30432-08-7, is a chemical compound that belongs to the class of cannabinoids. This substance features a complex polycyclic structure, characterized by a benzochromene core, which is typical of many naturally occurring cannabinoids. The presence of hydroxymethyl and pentyl groups contributes to its unique chemical properties and potential biological activities. It is known for its interaction with the endocannabinoid system, which may influence various physiological processes. The compound is typically studied for its potential therapeutic effects, including anti-inflammatory and analgesic properties. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and potential medicinal use. As with many cannabinoids, further studies are necessary to fully understand its pharmacological effects and safety profile.
Formula:C21H26O3
InChI:InChI=1/C21H26O3/c1-4-5-6-7-14-11-18(23)20-16-10-15(13-22)8-9-17(16)21(2,3)24-19(20)12-14/h8-12,22-23H,4-7,13H2,1-3H3
SMILES:CCCCCc1cc(c2c3cc(ccc3C(C)(C)Oc2c1)CO)O
Synonyms:- 6H-Dibenzo(b,d)pyran-9-methanol, 1-hydroxy-6,6-dimethyl-3-pentyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
11-Hydroxy cannabinol
CAS:11-Hydroxy cannabinol (Compound 5b) is an active metabolite of cannabinol.Formula:C21H26O3Color and Shape:SolidMolecular weight:326.43
