CAS 30433-78-4
:4-Methylthieno[3,2-c]pyridine
Description:
4-Methylthieno[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular structure includes a methyl group attached to the thieno ring, which can influence its reactivity and interactions with other molecules. The presence of both sulfur and nitrogen atoms in its structure imparts distinct electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. 4-Methylthieno[3,2-c]pyridine may exhibit biological activity, potentially serving as a scaffold for drug development. Its synthesis often involves multi-step reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound represents a valuable entity in the study of heterocyclic chemistry and its applications in pharmaceuticals and organic synthesis.
Formula:C8H7NS
InChI:InChI=1/C8H7NS/c1-6-7-3-5-10-8(7)2-4-9-6/h2-5H,1H3
SMILES:Cc1c2ccsc2ccn1
Synonyms:- Thieno[3,2-C]Pyridine, 4-Methyl-
- 4-Methylthieno[3,2-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
