CAS 304445-49-6
:1-(4-Bromo-3-fluorophenyl)ethanone
Description:
1-(4-Bromo-3-fluorophenyl)ethanone, with the CAS number 304445-49-6, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. The presence of a bromine atom and a fluorine atom on the phenyl ring contributes to its unique chemical properties, including increased reactivity and potential for various substitution reactions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various synthetic applications, particularly in medicinal chemistry and material science. The bromine and fluorine substituents can influence the compound's electronic properties, making it a candidate for further functionalization or as an intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns. Overall, 1-(4-Bromo-3-fluorophenyl)ethanone is a valuable compound in chemical research and development.
Formula:C8H6BrFO
InChI:InChI=1/C8H6BrFO/c1-5(11)6-2-3-7(9)8(10)4-6/h2-4H,1H3
SMILES:CC(=O)c1ccc(c(c1)F)Br
Synonyms:- 3-Fluoro-4-bromo-acetophenone
- 4-Bromo-3-fluoro-acetophenone
- Ethanone, 1-(4-Bromo-3-Fluorophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-3-fluoroacetophenone, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H6BrFOPurity:96%Molecular weight:217.04Ethanone, 1-(4-bromo-3-fluorophenyl)-
CAS:Formula:C8H6BrFOPurity:98%Color and Shape:SolidMolecular weight:217.03504’-Bromo-3’-fluoroacetophenone
CAS:4’-Bromo-3’-fluoroacetophenoneFormula:C8H6BrFOPurity:≥95%Color and Shape: white crystalline solidMolecular weight:217.04g/mol4-Bromo-3-fluoroacetophenone
CAS:Formula:C8H6BrFOPurity:95%Color and Shape:Solid, White powderMolecular weight:217.037



