CAS 304448-55-3
:3-Hydroxy-2-naphthalenecarboxylic acid 2-[(3,4-dihydroxyphenyl)methylene]hydrazide
Description:
3-Hydroxy-2-naphthalenecarboxylic acid 2-[(3,4-dihydroxyphenyl)methylene]hydrazide, with the CAS number 304448-55-3, is a chemical compound characterized by its complex structure, which includes a naphthalene ring and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, such as potential biological activity and solubility in organic solvents. The presence of hydroxyl groups suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the naphthalene moiety can contribute to its stability and potential for π-π stacking interactions. The compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for applications in drug development or as a biochemical probe. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C18H14N2O4
InChI:InChI=1S/C18H14N2O4/c21-15-6-5-11(7-17(15)23)10-19-20-18(24)14-8-12-3-1-2-4-13(12)9-16(14)22/h1-10,21-23H,(H,20,24)
InChI key:InChIKey=SYNDQCRDGGCQRZ-UHFFFAOYSA-N
SMILES:C(NN=CC1=CC(O)=C(O)C=C1)(=O)C2=CC3=C(C=C2O)C=CC=C3
Synonyms:- 2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(3,4-dihydroxyphenyl)methylene]hydrazide
- 2-Naphthalenecarboxylic acid, 3-hydroxy-, [(3,4-dihydroxyphenyl)methylene]hydrazide
- 3-Hydroxy-2-naphthalenecarboxylic acid 2-[(3,4-dihydroxyphenyl)methylene]hydrazide
- 3-Hydroxy-naphthalene-2-carboxylic acid (3,4-dihydroxy-benzylidene)-hydrazide
- Dynasore
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(3,4-dihydroxyphenyl)methylene]hydrazide
CAS:Formula:C18H14N2O4Purity:98%Color and Shape:SolidMolecular weight:322.3148Dynasore
CAS:Formula:C18H14N2O4Purity:>90.0%(HPLC)Color and Shape:White to Green to Brown powder to crystalMolecular weight:322.32Dynasore
CAS:Dynasore, a cell-permeable dynamin inhibitor, blocks GTPase of dynamin 1/2 and Drp1 (IC50: 15 μM) without affecting other small GTPases.Formula:C18H14N2O4Purity:95.85% - 99.22%Color and Shape:SolidMolecular weight:322.31Dynasore hydrate
CAS:Formula:C18H14N2O4·xH2OPurity:≥ 98.0%Color and Shape:White to off-white solidMolecular weight:322.31 (anhydrous)Dynamin Inhibitor I, Dynasore
CAS:Controlled Product<p>Applications Dynamin Inhibitor I, Dynasore is an inhibitor of Dynamin I and Dynamin II.<br></p>Formula:C18H14N2O4Color and Shape:Light BeigeMolecular weight:322.315Dynamin Inhibitor I, Dynasore
CAS:<p>Dynasore is a dynamin inhibitor that blocks the formation of large vesicles from small membrane fragments. Dynasore inhibits the nucleation of new vesicle formation by binding to the cytosolic domain of dynamin. This drug inhibits virus replication and mammalian cell entry by binding to the extracellular surface of the virion. Dynasore also prevents uptake of mammalian cells by extracellular parasites, such as Toxoplasma gondii and Plasmodium falciparum, and intracellular parasites, including Trypanosoma cruzi and Leishmania amazonensis. In addition, Dynasore inhibits mitochondrial fission in mammalian cells.</p>Formula:C18H14N2O4Purity:Min. 95%Molecular weight:322.31 g/mol






