CAS 30448-16-9

7-methyl-1H-indole-3-carboxylic acid

Description:

7-Methyl-1H-indole-3-carboxylic acid, with the CAS number 30448-16-9, is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a carboxylic acid functional group (-COOH) at the 3-position and a methyl group (-CH3) at the 7-position of the indole ring. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group contributes to its acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. This compound is of interest in medicinal chemistry and biochemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Additionally, it can serve as a building block in the synthesis of more complex organic molecules. Proper handling and storage are essential, as with many organic acids, to ensure safety and stability.

Formula: C₁₀H₉NO₂

InChI: InChI=1/C10H9NO2/c1-6-3-2-4-7-8(10(12)13)5-11-9(6)7/h2-5,11H,1H3,(H,12,13)

SMILES: Cc1cccc2c(c[nH]c12)C(=O)O

Synonyms:

• 1H-indole-3-carboxylic acid, 7-methyl-
• 7-Methylindole-3-carboxylic acid

1H-Indole-3-carboxylic acid, 7-methyl-

CAS: 30448-16-9

Formula: C₁₀H₉NO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 175.1840

Ref: IN-DA00305P

7-Methyl-1H-indole-3-carboxylic acid

CAS: 30448-16-9

7-Methyl-1H-indole-3-carboxylic acid

Purity: 99%

Molecular weight: 175.18g/mol

Ref: 54-OR913136

7-Methyl-1H-indole-3-carboxylic acid

CAS: 30448-16-9

Formula: C₁₀H₉NO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 175.187

Ref: 10-F079229